C42H71N2O5 — CID 134145278
CID 134145278 (PubChem CID 134145278) has the molecular formula C42H71N2O5 and a molecular weight of 684.04 g/mol.
| Compound Name | CID 134145278 |
|---|---|
| PubChem CID | 134145278 |
| Molecular Formula | C42H71N2O5 |
| Molecular Weight | 684.04 g/mol |
| Exact Mass | 683.54 |
| IUPAC Name | — |
| SMILES | Cc1c(C)c2c(c(C)c1OC(=O)CCC(=O)NC1CC(C)(C)N([O])C(C)(C)C1)CC[C@@](C)(CCC[C@H](C)CCC[C@H](C)CCCC(C)C)O2 |
| InChI | InChI=1S/C42H71N2O5/c1-28(2)16-13-17-29(3)18-14-19-30(4)20-15-24-42(12)25-23-35-33(7)38(31(5)32(6)39(35)49-42)48-37(46)22-21-36(45)43-34-26-40(8,9)44(47)41(10,11)27-34/h28-30,34H,13-27H2,1-12H3,(H,43,45)/t29-,30-,42-/m1/s1 |
| InChIKey | BZYWUIFLSKUFGK-YVKFVRAQSA-N |
| XLogP | 10.30 |
| TPSA | 87.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.04 |
| LogP ≤ 5 | 10.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|