C38H64N4O4 — CID 121333064
[(2R)-2,5,7,8-tetramethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-3,4-dihydrochromen-6-yl] 4-(5-azidopentylamino)-4-oxobutanoate (PubChem CID 121333064) has the molecular formula C38H64N4O4 and a molecular weight of 640.95 g/mol. Its IUPAC name is [(2R)-2,5,7,8-tetramethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-3,4-dihydrochromen-6-yl] 4-(5-azidopentylamino)-4-oxobutanoate.
| Compound Name | [(2R)-2,5,7,8-tetramethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-3,4-dihydrochromen-6-yl] 4-(5-azidopentylamino)-4-oxobutanoate |
|---|---|
| PubChem CID | 121333064 |
| Molecular Formula | C38H64N4O4 |
| Molecular Weight | 640.95 g/mol |
| Exact Mass | 640.49 |
| IUPAC Name | [(2R)-2,5,7,8-tetramethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-3,4-dihydrochromen-6-yl] 4-(5-azidopentylamino)-4-oxobutanoate |
| SMILES | Cc1c(C)c2c(c(C)c1OC(=O)CCC(=O)NCCCCCN=[N+]=[N-])CC[C@@](C)(CCC[C@H](C)CCC[C@H](C)CCCC(C)C)O2 |
| InChI | InChI=1S/C38H64N4O4/c1-27(2)15-12-16-28(3)17-13-18-29(4)19-14-23-38(8)24-22-33-32(7)36(30(5)31(6)37(33)46-38)45-35(44)21-20-34(43)40-25-10-9-11-26-41-42-39/h27-29H,9-26H2,1-8H3,(H,40,43)/t28-,29-,38-/m1/s1 |
| InChIKey | OYYBQIGANZPXHT-CZVCVAAJSA-N |
| XLogP | 10.42 |
| TPSA | 113.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.95 |
| LogP ≤ 5 | 10.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|