C34H56O5 — CID 145081796
[(2R)-2,5,7,8-tetramethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-3,4-dihydrochromen-6-yl] 3-(3-hydroxyoxiran-2-yl)propanoate (PubChem CID 145081796) has the molecular formula C34H56O5 and a molecular weight of 544.82 g/mol. Its IUPAC name is [(2R)-2,5,7,8-tetramethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-3,4-dihydrochromen-6-yl] 3-(3-hydroxyoxiran-2-yl)propanoate.
| Compound Name | [(2R)-2,5,7,8-tetramethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-3,4-dihydrochromen-6-yl] 3-(3-hydroxyoxiran-2-yl)propanoate |
|---|---|
| PubChem CID | 145081796 |
| Molecular Formula | C34H56O5 |
| Molecular Weight | 544.82 g/mol |
| Exact Mass | 544.41 |
| IUPAC Name | [(2R)-2,5,7,8-tetramethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-3,4-dihydrochromen-6-yl] 3-(3-hydroxyoxiran-2-yl)propanoate |
| SMILES | Cc1c(C)c2c(c(C)c1OC(=O)CCC1OC1O)CC[C@@](C)(CCC[C@H](C)CCC[C@H](C)CCCC(C)C)O2 |
| InChI | InChI=1S/C34H56O5/c1-22(2)12-9-13-23(3)14-10-15-24(4)16-11-20-34(8)21-19-28-27(7)31(25(5)26(6)32(28)39-34)38-30(35)18-17-29-33(36)37-29/h22-24,29,33,36H,9-21H2,1-8H3/t23-,24-,29?,33?,34-/m1/s1 |
| InChIKey | CXPOQHWVSQDAIX-WYSQUQBQSA-N |
| XLogP | 8.54 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.82 |
| LogP ≤ 5 | 8.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|