C25H35N3O3 — CID 23288024
2-[4-[(4,6-ditert-butyl-5-hydroxy-2-methyl-3H-1-benzofuran-2-yl)methoxy]phenyl]guanidine (PubChem CID 23288024) has the molecular formula C25H35N3O3 and a molecular weight of 425.57 g/mol. Its IUPAC name is 2-[4-[(4,6-ditert-butyl-5-hydroxy-2-methyl-3H-1-benzofuran-2-yl)methoxy]phenyl]guanidine.
| Compound Name | 2-[4-[(4,6-ditert-butyl-5-hydroxy-2-methyl-3H-1-benzofuran-2-yl)methoxy]phenyl]guanidine |
|---|---|
| PubChem CID | 23288024 |
| Molecular Formula | C25H35N3O3 |
| Molecular Weight | 425.57 g/mol |
| Exact Mass | 425.27 |
| IUPAC Name | 2-[4-[(4,6-ditert-butyl-5-hydroxy-2-methyl-3H-1-benzofuran-2-yl)methoxy]phenyl]guanidine |
| SMILES | CC1(COc2ccc(N=C(N)N)cc2)Cc2c(cc(C(C)(C)C)c(O)c2C(C)(C)C)O1 |
| InChI | InChI=1S/C25H35N3O3/c1-23(2,3)18-12-19-17(20(21(18)29)24(4,5)6)13-25(7,31-19)14-30-16-10-8-15(9-11-16)28-22(26)27/h8-12,29H,13-14H2,1-7H3,(H4,26,27,28) |
| InChIKey | KNFGVRWKZPYPJI-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 103.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.57 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|