C25H31NO3S — CID 139645257
[2-[2-(2,6-dimethylanilino)-2-sulfanylideneethyl]-2,5,7,8-tetramethyl-3,4-dihydrochromen-6-yl] acetate (PubChem CID 139645257) has the molecular formula C25H31NO3S and a molecular weight of 425.59 g/mol. Its IUPAC name is [2-[2-(2,6-dimethylanilino)-2-sulfanylideneethyl]-2,5,7,8-tetramethyl-3,4-dihydrochromen-6-yl] acetate.
| Compound Name | [2-[2-(2,6-dimethylanilino)-2-sulfanylideneethyl]-2,5,7,8-tetramethyl-3,4-dihydrochromen-6-yl] acetate |
|---|---|
| PubChem CID | 139645257 |
| Molecular Formula | C25H31NO3S |
| Molecular Weight | 425.59 g/mol |
| Exact Mass | 425.20 |
| IUPAC Name | [2-[2-(2,6-dimethylanilino)-2-sulfanylideneethyl]-2,5,7,8-tetramethyl-3,4-dihydrochromen-6-yl] acetate |
| SMILES | CC(=O)Oc1c(C)c(C)c2c(c1C)CCC(C)(CC(=S)Nc1c(C)cccc1C)O2 |
| InChI | InChI=1S/C25H31NO3S/c1-14-9-8-10-15(2)22(14)26-21(30)13-25(7)12-11-20-18(5)23(28-19(6)27)16(3)17(4)24(20)29-25/h8-10H,11-13H2,1-7H3,(H,26,30) |
| InChIKey | LIOTYSPWIFPZSX-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.59 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|