C27H30N2O3S — CID 139645273
[2,5,7,8-tetramethyl-2-[2-[(2-methylquinolin-4-yl)amino]-2-sulfanylideneethyl]-3,4-dihydrochromen-6-yl] acetate (PubChem CID 139645273) has the molecular formula C27H30N2O3S and a molecular weight of 462.62 g/mol. Its IUPAC name is [2,5,7,8-tetramethyl-2-[2-[(2-methylquinolin-4-yl)amino]-2-sulfanylideneethyl]-3,4-dihydrochromen-6-yl] acetate.
| Compound Name | [2,5,7,8-tetramethyl-2-[2-[(2-methylquinolin-4-yl)amino]-2-sulfanylideneethyl]-3,4-dihydrochromen-6-yl] acetate |
|---|---|
| PubChem CID | 139645273 |
| Molecular Formula | C27H30N2O3S |
| Molecular Weight | 462.62 g/mol |
| Exact Mass | 462.20 |
| IUPAC Name | [2,5,7,8-tetramethyl-2-[2-[(2-methylquinolin-4-yl)amino]-2-sulfanylideneethyl]-3,4-dihydrochromen-6-yl] acetate |
| SMILES | CC(=O)Oc1c(C)c(C)c2c(c1C)CCC(C)(CC(=S)Nc1cc(C)nc3ccccc13)O2 |
| InChI | InChI=1S/C27H30N2O3S/c1-15-13-23(21-9-7-8-10-22(21)28-15)29-24(33)14-27(6)12-11-20-18(4)25(31-19(5)30)16(2)17(3)26(20)32-27/h7-10,13H,11-12,14H2,1-6H3,(H,28,29,33) |
| InChIKey | XXZQVPTZOZENLV-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.62 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|