C27H31N3O3S — CID 139645266
[2-[2-[(5,7-dimethyl-1,8-naphthyridin-2-yl)amino]-2-sulfanylideneethyl]-2,5,7,8-tetramethyl-3,4-dihydrochromen-6-yl] acetate (PubChem CID 139645266) has the molecular formula C27H31N3O3S and a molecular weight of 477.63 g/mol. Its IUPAC name is [2-[2-[(5,7-dimethyl-1,8-naphthyridin-2-yl)amino]-2-sulfanylideneethyl]-2,5,7,8-tetramethyl-3,4-dihydrochromen-6-yl] acetate.
| Compound Name | [2-[2-[(5,7-dimethyl-1,8-naphthyridin-2-yl)amino]-2-sulfanylideneethyl]-2,5,7,8-tetramethyl-3,4-dihydrochromen-6-yl] acetate |
|---|---|
| PubChem CID | 139645266 |
| Molecular Formula | C27H31N3O3S |
| Molecular Weight | 477.63 g/mol |
| Exact Mass | 477.21 |
| IUPAC Name | [2-[2-[(5,7-dimethyl-1,8-naphthyridin-2-yl)amino]-2-sulfanylideneethyl]-2,5,7,8-tetramethyl-3,4-dihydrochromen-6-yl] acetate |
| SMILES | CC(=O)Oc1c(C)c(C)c2c(c1C)CCC(C)(CC(=S)Nc1ccc3c(C)cc(C)nc3n1)O2 |
| InChI | InChI=1S/C27H31N3O3S/c1-14-12-15(2)28-26-20(14)8-9-22(30-26)29-23(34)13-27(7)11-10-21-18(5)24(32-19(6)31)16(3)17(4)25(21)33-27/h8-9,12H,10-11,13H2,1-7H3,(H,28,29,30,34) |
| InChIKey | SCKYKPVFJMJBEB-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.63 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|