C27H44O3 — CID 118087548
[2-[(3S)-3-ethyl-3,5,6-trimethylheptyl]-2,5,7,8-tetramethyl-3,4-dihydrochromen-6-yl] acetate (PubChem CID 118087548) has the molecular formula C27H44O3 and a molecular weight of 416.65 g/mol. Its IUPAC name is [2-[(3S)-3-ethyl-3,5,6-trimethylheptyl]-2,5,7,8-tetramethyl-3,4-dihydrochromen-6-yl] acetate.
| Compound Name | [2-[(3S)-3-ethyl-3,5,6-trimethylheptyl]-2,5,7,8-tetramethyl-3,4-dihydrochromen-6-yl] acetate |
|---|---|
| PubChem CID | 118087548 |
| Molecular Formula | C27H44O3 |
| Molecular Weight | 416.65 g/mol |
| Exact Mass | 416.33 |
| IUPAC Name | [2-[(3S)-3-ethyl-3,5,6-trimethylheptyl]-2,5,7,8-tetramethyl-3,4-dihydrochromen-6-yl] acetate |
| SMILES | CC[C@@](C)(CCC1(C)CCc2c(C)c(OC(C)=O)c(C)c(C)c2O1)CC(C)C(C)C |
| InChI | InChI=1S/C27H44O3/c1-11-26(9,16-18(4)17(2)3)14-15-27(10)13-12-23-21(7)24(29-22(8)28)19(5)20(6)25(23)30-27/h17-18H,11-16H2,1-10H3/t18?,26-,27?/m0/s1 |
| InChIKey | RSULQMQSZWDHCP-BFNCGDNDSA-N |
| XLogP | 7.50 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.65 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|