C25H41NO3 — CID 118027249
[7-amino-2-(4,5-dimethylhexyl)-2,5,8-trimethyl-3,4-dihydrochromen-6-yl] 2,2-dimethylpropanoate (PubChem CID 118027249) has the molecular formula C25H41NO3 and a molecular weight of 403.61 g/mol. Its IUPAC name is [7-amino-2-(4,5-dimethylhexyl)-2,5,8-trimethyl-3,4-dihydrochromen-6-yl] 2,2-dimethylpropanoate.
| Compound Name | [7-amino-2-(4,5-dimethylhexyl)-2,5,8-trimethyl-3,4-dihydrochromen-6-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 118027249 |
| Molecular Formula | C25H41NO3 |
| Molecular Weight | 403.61 g/mol |
| Exact Mass | 403.31 |
| IUPAC Name | [7-amino-2-(4,5-dimethylhexyl)-2,5,8-trimethyl-3,4-dihydrochromen-6-yl] 2,2-dimethylpropanoate |
| SMILES | Cc1c2c(c(C)c(N)c1OC(=O)C(C)(C)C)OC(C)(CCCC(C)C(C)C)CC2 |
| InChI | InChI=1S/C25H41NO3/c1-15(2)16(3)11-10-13-25(9)14-12-19-17(4)22(28-23(27)24(6,7)8)20(26)18(5)21(19)29-25/h15-16H,10-14,26H2,1-9H3 |
| InChIKey | PSTCYIVCVBGRPY-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.61 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|