C35H60O6 — CID 19900609
(3,4-dihydroxy-3-methylbutyl) [2,5,7,8-tetramethyl-2-(4,8,12-trimethyltridecyl)-3,4-dihydrochromen-6-yl] carbonate (PubChem CID 19900609) has the molecular formula C35H60O6 and a molecular weight of 576.86 g/mol. Its IUPAC name is (3,4-dihydroxy-3-methylbutyl) [2,5,7,8-tetramethyl-2-(4,8,12-trimethyltridecyl)-3,4-dihydrochromen-6-yl] carbonate.
| Compound Name | (3,4-dihydroxy-3-methylbutyl) [2,5,7,8-tetramethyl-2-(4,8,12-trimethyltridecyl)-3,4-dihydrochromen-6-yl] carbonate |
|---|---|
| PubChem CID | 19900609 |
| Molecular Formula | C35H60O6 |
| Molecular Weight | 576.86 g/mol |
| Exact Mass | 576.44 |
| IUPAC Name | (3,4-dihydroxy-3-methylbutyl) [2,5,7,8-tetramethyl-2-(4,8,12-trimethyltridecyl)-3,4-dihydrochromen-6-yl] carbonate |
| SMILES | Cc1c(C)c2c(c(C)c1OC(=O)OCCC(C)(O)CO)CCC(C)(CCCC(C)CCCC(C)CCCC(C)C)O2 |
| InChI | InChI=1S/C35H60O6/c1-24(2)13-10-14-25(3)15-11-16-26(4)17-12-19-35(9)20-18-30-29(7)31(27(5)28(6)32(30)41-35)40-33(37)39-22-21-34(8,38)23-36/h24-26,36,38H,10-23H2,1-9H3 |
| InChIKey | RHYRPSBXBDKRAH-UHFFFAOYSA-N |
| XLogP | 8.78 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.86 |
| LogP ≤ 5 | 8.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|