C38H68O3 — CID 155713428
ethane;[2,5,7,8-tetramethyl-2-(4,8,12-trimethyltridecyl)-3,4-dihydrochromen-6-yl] 2,2-dimethylpentanoate (PubChem CID 155713428) has the molecular formula C38H68O3 and a molecular weight of 572.96 g/mol. Its IUPAC name is ethane;[2,5,7,8-tetramethyl-2-(4,8,12-trimethyltridecyl)-3,4-dihydrochromen-6-yl] 2,2-dimethylpentanoate.
| Compound Name | ethane;[2,5,7,8-tetramethyl-2-(4,8,12-trimethyltridecyl)-3,4-dihydrochromen-6-yl] 2,2-dimethylpentanoate |
|---|---|
| PubChem CID | 155713428 |
| Molecular Formula | C38H68O3 |
| Molecular Weight | 572.96 g/mol |
| Exact Mass | 572.52 |
| IUPAC Name | ethane;[2,5,7,8-tetramethyl-2-(4,8,12-trimethyltridecyl)-3,4-dihydrochromen-6-yl] 2,2-dimethylpentanoate |
| SMILES | CC.CCCC(C)(C)C(=O)Oc1c(C)c(C)c2c(c1C)CCC(C)(CCCC(C)CCCC(C)CCCC(C)C)O2 |
| InChI | InChI=1S/C36H62O3.C2H6/c1-12-22-35(9,10)34(37)38-32-28(6)29(7)33-31(30(32)8)21-24-36(11,39-33)23-15-20-27(5)19-14-18-26(4)17-13-16-25(2)3;1-2/h25-27H,12-24H2,1-11H3;1-2H3 |
| InChIKey | IZLPRHODPBWIBB-UHFFFAOYSA-N |
| XLogP | 11.89 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.96 |
| LogP ≤ 5 | 11.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|