C31H49NO3 — CID 58771202
[(2R)-5-cyano-2,7,8-trimethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-3,4-dihydrochromen-6-yl] acetate (PubChem CID 58771202) has the molecular formula C31H49NO3 and a molecular weight of 483.74 g/mol. Its IUPAC name is [(2R)-5-cyano-2,7,8-trimethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-3,4-dihydrochromen-6-yl] acetate.
| Compound Name | [(2R)-5-cyano-2,7,8-trimethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-3,4-dihydrochromen-6-yl] acetate |
|---|---|
| PubChem CID | 58771202 |
| Molecular Formula | C31H49NO3 |
| Molecular Weight | 483.74 g/mol |
| Exact Mass | 483.37 |
| IUPAC Name | [(2R)-5-cyano-2,7,8-trimethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-3,4-dihydrochromen-6-yl] acetate |
| SMILES | CC(=O)Oc1c(C)c(C)c2c(c1C#N)CC[C@@](C)(CCC[C@H](C)CCC[C@H](C)CCCC(C)C)O2 |
| InChI | InChI=1S/C31H49NO3/c1-21(2)12-9-13-22(3)14-10-15-23(4)16-11-18-31(8)19-17-27-28(20-32)29(34-26(7)33)24(5)25(6)30(27)35-31/h21-23H,9-19H2,1-8H3/t22-,23-,31-/m1/s1 |
| InChIKey | OVKCSPNUCXRDPR-CEFNRUSXSA-N |
| XLogP | 8.62 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.74 |
| LogP ≤ 5 | 8.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|