C30H51NO3 — CID 134186048
[(2R)-2-amino-5,7,8-trimethyl-2-(4,8,12-trimethyltridecyl)-3,4-dihydrochromen-6-yl] acetate (PubChem CID 134186048) has the molecular formula C30H51NO3 and a molecular weight of 473.74 g/mol. Its IUPAC name is [(2R)-2-amino-5,7,8-trimethyl-2-(4,8,12-trimethyltridecyl)-3,4-dihydrochromen-6-yl] acetate.
| Compound Name | [(2R)-2-amino-5,7,8-trimethyl-2-(4,8,12-trimethyltridecyl)-3,4-dihydrochromen-6-yl] acetate |
|---|---|
| PubChem CID | 134186048 |
| Molecular Formula | C30H51NO3 |
| Molecular Weight | 473.74 g/mol |
| Exact Mass | 473.39 |
| IUPAC Name | [(2R)-2-amino-5,7,8-trimethyl-2-(4,8,12-trimethyltridecyl)-3,4-dihydrochromen-6-yl] acetate |
| SMILES | CC(=O)Oc1c(C)c(C)c2c(c1C)CC[C@@](N)(CCCC(C)CCCC(C)CCCC(C)C)O2 |
| InChI | InChI=1S/C30H51NO3/c1-20(2)12-9-13-21(3)14-10-15-22(4)16-11-18-30(31)19-17-27-25(7)28(33-26(8)32)23(5)24(6)29(27)34-30/h20-22H,9-19,31H2,1-8H3/t21?,22?,30-/m1/s1 |
| InChIKey | FJHRFULINQNDIF-SWFUTCNKSA-N |
| XLogP | 7.96 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.74 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|