C37H46N2O7 — CID 85047495
[2-[[4-[(2,6-ditert-butyl-4-hydroxybenzoyl)amino]phenoxy]methyl]-4-hydroxyimino-2,5,7,8-tetramethyl-3H-chromen-6-yl] acetate (PubChem CID 85047495) has the molecular formula C37H46N2O7 and a molecular weight of 630.78 g/mol. Its IUPAC name is [2-[[4-[(2,6-ditert-butyl-4-hydroxybenzoyl)amino]phenoxy]methyl]-4-hydroxyimino-2,5,7,8-tetramethyl-3H-chromen-6-yl] acetate.
| Compound Name | [2-[[4-[(2,6-ditert-butyl-4-hydroxybenzoyl)amino]phenoxy]methyl]-4-hydroxyimino-2,5,7,8-tetramethyl-3H-chromen-6-yl] acetate |
|---|---|
| PubChem CID | 85047495 |
| Molecular Formula | C37H46N2O7 |
| Molecular Weight | 630.78 g/mol |
| Exact Mass | 630.33 |
| IUPAC Name | [2-[[4-[(2,6-ditert-butyl-4-hydroxybenzoyl)amino]phenoxy]methyl]-4-hydroxyimino-2,5,7,8-tetramethyl-3H-chromen-6-yl] acetate |
| SMILES | CC(=O)Oc1c(C)c(C)c2c(c1C)C(=NO)CC(C)(COc1ccc(NC(=O)c3c(C(C)(C)C)cc(O)cc3C(C)(C)C)cc1)O2 |
| InChI | InChI=1S/C37H46N2O7/c1-20-21(2)33-30(22(3)32(20)45-23(4)40)29(39-43)18-37(11,46-33)19-44-26-14-12-24(13-15-26)38-34(42)31-27(35(5,6)7)16-25(41)17-28(31)36(8,9)10/h12-17,41,43H,18-19H2,1-11H3,(H,38,42) |
| InChIKey | KILJAYNKWTXHCF-UHFFFAOYSA-N |
| XLogP | 7.89 |
| TPSA | 126.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.78 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|