C20H24O2 — CID 70422364
(2S)-2,5,7,8-tetramethyl-6-phenylmethoxy-3,4-dihydro-2H-chromene (PubChem CID 70422364) has the molecular formula C20H24O2 and a molecular weight of 296.41 g/mol. Its IUPAC name is (2S)-2,5,7,8-tetramethyl-6-phenylmethoxy-3,4-dihydro-2H-chromene.
| Compound Name | (2S)-2,5,7,8-tetramethyl-6-phenylmethoxy-3,4-dihydro-2H-chromene |
|---|---|
| PubChem CID | 70422364 |
| Molecular Formula | C20H24O2 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.18 |
| IUPAC Name | (2S)-2,5,7,8-tetramethyl-6-phenylmethoxy-3,4-dihydro-2H-chromene |
| SMILES | Cc1c(C)c2c(c(C)c1OCc1ccccc1)CC[C@H](C)O2 |
| InChI | InChI=1S/C20H24O2/c1-13-10-11-18-16(4)19(14(2)15(3)20(18)22-13)21-12-17-8-6-5-7-9-17/h5-9,13H,10-12H2,1-4H3/t13-/m0/s1 |
| InChIKey | TWYIROONGVIKEA-ZDUSSCGKSA-N |
| XLogP | 4.90 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |