C20H22O2 — CID 10108511
2,5,7,8-tetramethyl-6-phenylmethoxy-4H-chromene (PubChem CID 10108511) has the molecular formula C20H22O2 and a molecular weight of 294.39 g/mol. Its IUPAC name is 2,5,7,8-tetramethyl-6-phenylmethoxy-4H-chromene.
| Compound Name | 2,5,7,8-tetramethyl-6-phenylmethoxy-4H-chromene |
|---|---|
| PubChem CID | 10108511 |
| Molecular Formula | C20H22O2 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | 2,5,7,8-tetramethyl-6-phenylmethoxy-4H-chromene |
| SMILES | CC1=CCc2c(C)c(OCc3ccccc3)c(C)c(C)c2O1 |
| InChI | InChI=1S/C20H22O2/c1-13-10-11-18-16(4)19(14(2)15(3)20(18)22-13)21-12-17-8-6-5-7-9-17/h5-10H,11-12H2,1-4H3 |
| InChIKey | NDOGZWHXIIZROA-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |