C25H30O3 — CID 70621879
(2R)-2,5,7,8-tetramethyl-3-pent-1-ynyl-6-phenylmethoxy-3,4-dihydrochromen-2-ol (PubChem CID 70621879) has the molecular formula C25H30O3 and a molecular weight of 378.51 g/mol. Its IUPAC name is (2R)-2,5,7,8-tetramethyl-3-pent-1-ynyl-6-phenylmethoxy-3,4-dihydrochromen-2-ol.
| Compound Name | (2R)-2,5,7,8-tetramethyl-3-pent-1-ynyl-6-phenylmethoxy-3,4-dihydrochromen-2-ol |
|---|---|
| PubChem CID | 70621879 |
| Molecular Formula | C25H30O3 |
| Molecular Weight | 378.51 g/mol |
| Exact Mass | 378.22 |
| IUPAC Name | (2R)-2,5,7,8-tetramethyl-3-pent-1-ynyl-6-phenylmethoxy-3,4-dihydrochromen-2-ol |
| SMILES | CCCC#CC1Cc2c(C)c(OCc3ccccc3)c(C)c(C)c2O[C@@]1(C)O |
| InChI | InChI=1S/C25H30O3/c1-6-7-9-14-21-15-22-19(4)23(27-16-20-12-10-8-11-13-20)17(2)18(3)24(22)28-25(21,5)26/h8,10-13,21,26H,6-7,15-16H2,1-5H3/t21?,25-/m1/s1 |
| InChIKey | HREVDHVBSHWMQD-UIDYPRJRSA-N |
| XLogP | 5.25 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.51 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|