C24H24O3 — CID 86653777
2,4,5-trimethyl-3,6-bis(phenylmethoxy)benzaldehyde (PubChem CID 86653777) has the molecular formula C24H24O3 and a molecular weight of 360.45 g/mol. Its IUPAC name is 2,4,5-trimethyl-3,6-bis(phenylmethoxy)benzaldehyde.
| Compound Name | 2,4,5-trimethyl-3,6-bis(phenylmethoxy)benzaldehyde |
|---|---|
| PubChem CID | 86653777 |
| Molecular Formula | C24H24O3 |
| Molecular Weight | 360.45 g/mol |
| Exact Mass | 360.17 |
| IUPAC Name | 2,4,5-trimethyl-3,6-bis(phenylmethoxy)benzaldehyde |
| SMILES | Cc1c(C)c(OCc2ccccc2)c(C=O)c(C)c1OCc1ccccc1 |
| InChI | InChI=1S/C24H24O3/c1-17-18(2)24(27-16-21-12-8-5-9-13-21)22(14-25)19(3)23(17)26-15-20-10-6-4-7-11-20/h4-14H,15-16H2,1-3H3 |
| InChIKey | WANXQRLWUNLKLI-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.45 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|