C17H18O3 — CID 142270247
4-methoxy-2,5-dimethyl-3-phenylmethoxybenzaldehyde (PubChem CID 142270247) has the molecular formula C17H18O3 and a molecular weight of 270.33 g/mol. Its IUPAC name is 4-methoxy-2,5-dimethyl-3-phenylmethoxybenzaldehyde.
| Compound Name | 4-methoxy-2,5-dimethyl-3-phenylmethoxybenzaldehyde |
|---|---|
| PubChem CID | 142270247 |
| Molecular Formula | C17H18O3 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.13 |
| IUPAC Name | 4-methoxy-2,5-dimethyl-3-phenylmethoxybenzaldehyde |
| SMILES | COc1c(C)cc(C=O)c(C)c1OCc1ccccc1 |
| InChI | InChI=1S/C17H18O3/c1-12-9-15(10-18)13(2)17(16(12)19-3)20-11-14-7-5-4-6-8-14/h4-10H,11H2,1-3H3 |
| InChIKey | IYPGHDOLKHRPPF-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|