About potassium;3-methoxy-2-phenylmethoxybenzaldehyde;hydroxide
potassium;3-methoxy-2-phenylmethoxybenzaldehyde;hydroxide (PubChem CID 160863194) has the molecular formula C15H15KO4
and a molecular weight of 298.38 g/mol. Its IUPAC name is potassium;3-methoxy-2-phenylmethoxybenzaldehyde;hydroxide.
Molecular Properties
| Compound Name | potassium;3-methoxy-2-phenylmethoxybenzaldehyde;hydroxide |
| PubChem CID | 160863194 |
| Molecular Formula | C15H15KO4 |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.06 |
| IUPAC Name | potassium;3-methoxy-2-phenylmethoxybenzaldehyde;hydroxide |
| SMILES | COc1cccc(C=O)c1OCc1ccccc1.[K+].[OH-] |
| InChI | InChI=1S/C15H14O3.K.H2O/c1-17-14-9-5-8-13(10-16)15(14)18-11-12-6-3-2-4-7-12;;/h2-10H,11H2,1H3;;1H2/q;+1;/p-1 |
| InChIKey | SKTKBSGKEDUPGA-UHFFFAOYSA-M |
| XLogP | -0.09 |
| TPSA | 65.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze potassium;3-methoxy-2-phenylmethoxybenzaldehyde;hydroxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;3-methoxy-2-phenylmethoxybenzaldehyde;hydroxide?
The IUPAC name of potassium;3-methoxy-2-phenylmethoxybenzaldehyde;hydroxide (CID 160863194) is potassium;3-methoxy-2-phenylmethoxybenzaldehyde;hydroxide.
What is the SMILES notation for potassium;3-methoxy-2-phenylmethoxybenzaldehyde;hydroxide?
The canonical SMILES for potassium;3-methoxy-2-phenylmethoxybenzaldehyde;hydroxide is COc1cccc(C=O)c1OCc1ccccc1.[K+].[OH-].
What is the InChIKey of potassium;3-methoxy-2-phenylmethoxybenzaldehyde;hydroxide?
The InChIKey is SKTKBSGKEDUPGA-UHFFFAOYSA-M. The full InChI is InChI=1S/C15H14O3.K.H2O/c1-17-14-9-5-8-13(10-16)15(14)18-11-12-6-3-2-4-7-12;;/h2-10H,11H2,1H3;;1H2/q;+1;/p-1.
What are the key properties of potassium;3-methoxy-2-phenylmethoxybenzaldehyde;hydroxide?
potassium;3-methoxy-2-phenylmethoxybenzaldehyde;hydroxide has a molecular weight of 298.38 g/mol, XLogP of -0.09, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;3-methoxy-2-phenylmethoxybenzaldehyde;hydroxide is sourced from PubChem (CID 160863194), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).