C18H20O5S — CID 14822828
2-(3-methyl-2H-1,4-benzodioxin-3-yl)ethyl 4-methylbenzenesulfonate (PubChem CID 14822828) has the molecular formula C18H20O5S and a molecular weight of 348.42 g/mol. Its IUPAC name is 2-(3-methyl-2H-1,4-benzodioxin-3-yl)ethyl 4-methylbenzenesulfonate.
| Compound Name | 2-(3-methyl-2H-1,4-benzodioxin-3-yl)ethyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 14822828 |
| Molecular Formula | C18H20O5S |
| Molecular Weight | 348.42 g/mol |
| Exact Mass | 348.10 |
| IUPAC Name | 2-(3-methyl-2H-1,4-benzodioxin-3-yl)ethyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCCC2(C)COc3ccccc3O2)cc1 |
| InChI | InChI=1S/C18H20O5S/c1-14-7-9-15(10-8-14)24(19,20)22-12-11-18(2)13-21-16-5-3-4-6-17(16)23-18/h3-10H,11-13H2,1-2H3 |
| InChIKey | MPPHCXNEHMTVMH-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.42 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|