C17H18O6S — CID 87756569
[(3R)-5-hydroxy-3-methyl-2H-1,4-benzodioxin-3-yl]methyl 4-methylbenzenesulfonate (PubChem CID 87756569) has the molecular formula C17H18O6S and a molecular weight of 350.39 g/mol. Its IUPAC name is [(3R)-5-hydroxy-3-methyl-2H-1,4-benzodioxin-3-yl]methyl 4-methylbenzenesulfonate.
| Compound Name | [(3R)-5-hydroxy-3-methyl-2H-1,4-benzodioxin-3-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 87756569 |
| Molecular Formula | C17H18O6S |
| Molecular Weight | 350.39 g/mol |
| Exact Mass | 350.08 |
| IUPAC Name | [(3R)-5-hydroxy-3-methyl-2H-1,4-benzodioxin-3-yl]methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@@]2(C)COc3cccc(O)c3O2)cc1 |
| InChI | InChI=1S/C17H18O6S/c1-12-6-8-13(9-7-12)24(19,20)22-11-17(2)10-21-15-5-3-4-14(18)16(15)23-17/h3-9,18H,10-11H2,1-2H3/t17-/m1/s1 |
| InChIKey | MEONPKWNFHOGCP-QGZVFWFLSA-N |
| XLogP | 2.64 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.39 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|