C15H22O5S — CID 13343712
2-[(4S)-2,2,4-trimethyl-1,3-dioxolan-4-yl]ethyl 4-methylbenzenesulfonate (PubChem CID 13343712) has the molecular formula C15H22O5S and a molecular weight of 314.40 g/mol. Its IUPAC name is 2-[(4S)-2,2,4-trimethyl-1,3-dioxolan-4-yl]ethyl 4-methylbenzenesulfonate.
| Compound Name | 2-[(4S)-2,2,4-trimethyl-1,3-dioxolan-4-yl]ethyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 13343712 |
| Molecular Formula | C15H22O5S |
| Molecular Weight | 314.40 g/mol |
| Exact Mass | 314.12 |
| IUPAC Name | 2-[(4S)-2,2,4-trimethyl-1,3-dioxolan-4-yl]ethyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCC[C@@]2(C)COC(C)(C)O2)cc1 |
| InChI | InChI=1S/C15H22O5S/c1-12-5-7-13(8-6-12)21(16,17)19-10-9-15(4)11-18-14(2,3)20-15/h5-8H,9-11H2,1-4H3/t15-/m0/s1 |
| InChIKey | UVYAXFCKESNMBG-HNNXBMFYSA-N |
| XLogP | 2.63 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.40 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|