C33H56O5 — CID 71540907
ethyl 2-[[(2S)-2,5,7,8-tetramethyl-2-(3,7,11-trimethyldodecoxymethyl)-3,4-dihydrochromen-6-yl]oxy]acetate (PubChem CID 71540907) has the molecular formula C33H56O5 and a molecular weight of 532.81 g/mol. Its IUPAC name is ethyl 2-[[(2S)-2,5,7,8-tetramethyl-2-(3,7,11-trimethyldodecoxymethyl)-3,4-dihydrochromen-6-yl]oxy]acetate.
| Compound Name | ethyl 2-[[(2S)-2,5,7,8-tetramethyl-2-(3,7,11-trimethyldodecoxymethyl)-3,4-dihydrochromen-6-yl]oxy]acetate |
|---|---|
| PubChem CID | 71540907 |
| Molecular Formula | C33H56O5 |
| Molecular Weight | 532.81 g/mol |
| Exact Mass | 532.41 |
| IUPAC Name | ethyl 2-[[(2S)-2,5,7,8-tetramethyl-2-(3,7,11-trimethyldodecoxymethyl)-3,4-dihydrochromen-6-yl]oxy]acetate |
| SMILES | CCOC(=O)COc1c(C)c(C)c2c(c1C)CC[C@@](C)(COCCC(C)CCCC(C)CCCC(C)C)O2 |
| InChI | InChI=1S/C33H56O5/c1-10-36-30(34)21-37-31-26(6)27(7)32-29(28(31)8)17-19-33(9,38-32)22-35-20-18-25(5)16-12-15-24(4)14-11-13-23(2)3/h23-25H,10-22H2,1-9H3/t24?,25?,33-/m0/s1 |
| InChIKey | JMVPGMCBDHEXCU-JEPZBRSCSA-N |
| XLogP | 8.31 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.81 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|