C28H30BrNO7S — CID 143252127
[2-[[4-[(Z)-3-amino-2-formylsulfanyl-3-oxoprop-1-enyl]-2-bromophenoxy]methyl]-2,5,7,8-tetramethyl-3,4-dihydrochromen-6-yl] (E)-4-hydroxybut-2-enoate (PubChem CID 143252127) has the molecular formula C28H30BrNO7S and a molecular weight of 604.52 g/mol. Its IUPAC name is [2-[[4-[(Z)-3-amino-2-formylsulfanyl-3-oxoprop-1-enyl]-2-bromophenoxy]methyl]-2,5,7,8-tetramethyl-3,4-dihydrochromen-6-yl] (E)-4-hydroxybut-2-enoate.
| Compound Name | [2-[[4-[(Z)-3-amino-2-formylsulfanyl-3-oxoprop-1-enyl]-2-bromophenoxy]methyl]-2,5,7,8-tetramethyl-3,4-dihydrochromen-6-yl] (E)-4-hydroxybut-2-enoate |
|---|---|
| PubChem CID | 143252127 |
| Molecular Formula | C28H30BrNO7S |
| Molecular Weight | 604.52 g/mol |
| Exact Mass | 603.09 |
| IUPAC Name | [2-[[4-[(Z)-3-amino-2-formylsulfanyl-3-oxoprop-1-enyl]-2-bromophenoxy]methyl]-2,5,7,8-tetramethyl-3,4-dihydrochromen-6-yl] (E)-4-hydroxybut-2-enoate |
| SMILES | Cc1c(C)c2c(c(C)c1OC(=O)/C=C/CO)CCC(C)(COc1ccc(/C=C(\SC=O)C(N)=O)cc1Br)O2 |
| InChI | InChI=1S/C28H30BrNO7S/c1-16-17(2)26-20(18(3)25(16)36-24(33)6-5-11-31)9-10-28(4,37-26)14-35-22-8-7-19(12-21(22)29)13-23(27(30)34)38-15-32/h5-8,12-13,15,31H,9-11,14H2,1-4H3,(H2,30,34)/b6-5+,23-13- |
| InChIKey | JAMLVINTGICYHJ-QNIGGNBHSA-N |
| XLogP | 4.74 |
| TPSA | 125.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.52 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|