C28H28BrNO8S — CID 73003154
4-[[2-[[2-bromo-4-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenoxy]methyl]-2,5,7,8-tetramethyl-3,4-dihydrochromen-6-yl]oxy]-4-oxobutanoic acid (PubChem CID 73003154) has the molecular formula C28H28BrNO8S and a molecular weight of 618.50 g/mol. Its IUPAC name is 4-[[2-[[2-bromo-4-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenoxy]methyl]-2,5,7,8-tetramethyl-3,4-dihydrochromen-6-yl]oxy]-4-oxobutanoic acid.
| Compound Name | 4-[[2-[[2-bromo-4-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenoxy]methyl]-2,5,7,8-tetramethyl-3,4-dihydrochromen-6-yl]oxy]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 73003154 |
| Molecular Formula | C28H28BrNO8S |
| Molecular Weight | 618.50 g/mol |
| Exact Mass | 617.07 |
| IUPAC Name | 4-[[2-[[2-bromo-4-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenoxy]methyl]-2,5,7,8-tetramethyl-3,4-dihydrochromen-6-yl]oxy]-4-oxobutanoic acid |
| SMILES | Cc1c(C)c2c(c(C)c1OC(=O)CCC(=O)O)CCC(C)(COc1ccc(C=C3SC(=O)NC3=O)cc1Br)O2 |
| InChI | InChI=1S/C28H28BrNO8S/c1-14-15(2)25-18(16(3)24(14)37-23(33)8-7-22(31)32)9-10-28(4,38-25)13-36-20-6-5-17(11-19(20)29)12-21-26(34)30-27(35)39-21/h5-6,11-12H,7-10,13H2,1-4H3,(H,31,32)(H,30,34,35) |
| InChIKey | UPEFDIDCUKOWCC-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 128.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.50 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|