C33H39FN2O5S — CID 87438821
6-[[2-[[4-[(E)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-2-(fluoromethyl)phenoxy]methyl]-2,5,7,8-tetramethyl-3,4-dihydrochromen-6-yl]oxy]-2,2-dimethylhexanenitrile (PubChem CID 87438821) has the molecular formula C33H39FN2O5S and a molecular weight of 594.75 g/mol. Its IUPAC name is 6-[[2-[[4-[(E)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-2-(fluoromethyl)phenoxy]methyl]-2,5,7,8-tetramethyl-3,4-dihydrochromen-6-yl]oxy]-2,2-dimethylhexanenitrile.
| Compound Name | 6-[[2-[[4-[(E)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-2-(fluoromethyl)phenoxy]methyl]-2,5,7,8-tetramethyl-3,4-dihydrochromen-6-yl]oxy]-2,2-dimethylhexanenitrile |
|---|---|
| PubChem CID | 87438821 |
| Molecular Formula | C33H39FN2O5S |
| Molecular Weight | 594.75 g/mol |
| Exact Mass | 594.26 |
| IUPAC Name | 6-[[2-[[4-[(E)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-2-(fluoromethyl)phenoxy]methyl]-2,5,7,8-tetramethyl-3,4-dihydrochromen-6-yl]oxy]-2,2-dimethylhexanenitrile |
| SMILES | Cc1c(C)c2c(c(C)c1OCCCCC(C)(C)C#N)CCC(C)(COc1ccc(/C=C3/SC(=O)NC3=O)cc1CF)O2 |
| InChI | InChI=1S/C33H39FN2O5S/c1-20-21(2)29-25(22(3)28(20)39-14-8-7-12-32(4,5)18-35)11-13-33(6,41-29)19-40-26-10-9-23(15-24(26)17-34)16-27-30(37)36-31(38)42-27/h9-10,15-16H,7-8,11-14,17,19H2,1-6H3,(H,36,37,38)/b27-16+ |
| InChIKey | WCLZLADREWODCP-JVWAILMASA-N |
| XLogP | 7.67 |
| TPSA | 97.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.75 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|