C30H33BrN2O5S — CID 87348287
6-[[2-[[2-bromo-4-[(E)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenoxy]methyl]-2,5,7,8-tetramethyl-3,4-dihydrochromen-6-yl]oxy]hexanenitrile (PubChem CID 87348287) has the molecular formula C30H33BrN2O5S and a molecular weight of 613.57 g/mol. Its IUPAC name is 6-[[2-[[2-bromo-4-[(E)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenoxy]methyl]-2,5,7,8-tetramethyl-3,4-dihydrochromen-6-yl]oxy]hexanenitrile.
| Compound Name | 6-[[2-[[2-bromo-4-[(E)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenoxy]methyl]-2,5,7,8-tetramethyl-3,4-dihydrochromen-6-yl]oxy]hexanenitrile |
|---|---|
| PubChem CID | 87348287 |
| Molecular Formula | C30H33BrN2O5S |
| Molecular Weight | 613.57 g/mol |
| Exact Mass | 612.13 |
| IUPAC Name | 6-[[2-[[2-bromo-4-[(E)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenoxy]methyl]-2,5,7,8-tetramethyl-3,4-dihydrochromen-6-yl]oxy]hexanenitrile |
| SMILES | Cc1c(C)c2c(c(C)c1OCCCCCC#N)CCC(C)(COc1ccc(/C=C3/SC(=O)NC3=O)cc1Br)O2 |
| InChI | InChI=1S/C30H33BrN2O5S/c1-18-19(2)27-22(20(3)26(18)36-14-8-6-5-7-13-32)11-12-30(4,38-27)17-37-24-10-9-21(15-23(24)31)16-25-28(34)33-29(35)39-25/h9-10,15-16H,5-8,11-12,14,17H2,1-4H3,(H,33,34,35)/b25-16+ |
| InChIKey | HKDYYGOBICXAQK-PCLIKHOPSA-N |
| XLogP | 7.32 |
| TPSA | 97.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.57 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|