C29H37NO6S — CID 143852298
6-butoxy-2,5,7,8-tetramethyl-3,4-dihydro-2H-chromene;(5E)-5-[(3,4-dimethoxyphenyl)methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 143852298) has the molecular formula C29H37NO6S and a molecular weight of 527.68 g/mol. Its IUPAC name is 6-butoxy-2,5,7,8-tetramethyl-3,4-dihydro-2H-chromene;(5E)-5-[(3,4-dimethoxyphenyl)methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | 6-butoxy-2,5,7,8-tetramethyl-3,4-dihydro-2H-chromene;(5E)-5-[(3,4-dimethoxyphenyl)methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 143852298 |
| Molecular Formula | C29H37NO6S |
| Molecular Weight | 527.68 g/mol |
| Exact Mass | 527.23 |
| IUPAC Name | 6-butoxy-2,5,7,8-tetramethyl-3,4-dihydro-2H-chromene;(5E)-5-[(3,4-dimethoxyphenyl)methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | CCCCOc1c(C)c(C)c2c(c1C)CCC(C)O2.COc1ccc(/C=C2/SC(=O)NC2=O)cc1OC |
| InChI | InChI=1S/C17H26O2.C12H11NO4S/c1-6-7-10-18-16-12(3)13(4)17-15(14(16)5)9-8-11(2)19-17;1-16-8-4-3-7(5-9(8)17-2)6-10-11(14)13-12(15)18-10/h11H,6-10H2,1-5H3;3-6H,1-2H3,(H,13,14,15)/b;10-6+ |
| InChIKey | SUXBLZCTHNBWEE-LOQGCFKBSA-N |
| XLogP | 6.53 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.68 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|