C24H25NO6S — CID 173180702
4-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]benzoic acid;2,5,7,8-tetramethyl-3,4-dihydro-2H-chromen-6-ol (PubChem CID 173180702) has the molecular formula C24H25NO6S and a molecular weight of 455.53 g/mol. Its IUPAC name is 4-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]benzoic acid;2,5,7,8-tetramethyl-3,4-dihydro-2H-chromen-6-ol.
| Compound Name | 4-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]benzoic acid;2,5,7,8-tetramethyl-3,4-dihydro-2H-chromen-6-ol |
|---|---|
| PubChem CID | 173180702 |
| Molecular Formula | C24H25NO6S |
| Molecular Weight | 455.53 g/mol |
| Exact Mass | 455.14 |
| IUPAC Name | 4-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]benzoic acid;2,5,7,8-tetramethyl-3,4-dihydro-2H-chromen-6-ol |
| SMILES | Cc1c(C)c2c(c(C)c1O)CCC(C)O2.O=C1NC(=O)C(=Cc2ccc(C(=O)O)cc2)S1 |
| InChI | InChI=1S/C13H18O2.C11H7NO4S/c1-7-5-6-11-10(4)12(14)8(2)9(3)13(11)15-7;13-9-8(17-11(16)12-9)5-6-1-3-7(4-2-6)10(14)15/h7,14H,5-6H2,1-4H3;1-5H,(H,14,15)(H,12,13,16) |
| InChIKey | VBSGMRHJTYWOIL-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.53 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|