C21H18N2O3S — CID 9488439
(5Z)-5-[[4-[(2S)-2-methyl-3,4-dihydro-2H-quinoline-1-carbonyl]phenyl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 9488439) has the molecular formula C21H18N2O3S and a molecular weight of 378.45 g/mol. Its IUPAC name is (5Z)-5-[[4-[(2S)-2-methyl-3,4-dihydro-2H-quinoline-1-carbonyl]phenyl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[4-[(2S)-2-methyl-3,4-dihydro-2H-quinoline-1-carbonyl]phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 9488439 |
| Molecular Formula | C21H18N2O3S |
| Molecular Weight | 378.45 g/mol |
| Exact Mass | 378.10 |
| IUPAC Name | (5Z)-5-[[4-[(2S)-2-methyl-3,4-dihydro-2H-quinoline-1-carbonyl]phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | C[C@H]1CCc2ccccc2N1C(=O)c1ccc(/C=C2\SC(=O)NC2=O)cc1 |
| InChI | InChI=1S/C21H18N2O3S/c1-13-6-9-15-4-2-3-5-17(15)23(13)20(25)16-10-7-14(8-11-16)12-18-19(24)22-21(26)27-18/h2-5,7-8,10-13H,6,9H2,1H3,(H,22,24,26)/b18-12-/t13-/m0/s1 |
| InChIKey | KNEZSCZDQLWAPH-CYUIRQCWSA-N |
| XLogP | 3.99 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.45 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|