C14H18BrNO — CID 116816888
2-bromo-2-methyl-1-(2-methyl-3,4-dihydro-2H-quinolin-1-yl)propan-1-one (PubChem CID 116816888) has the molecular formula C14H18BrNO and a molecular weight of 296.21 g/mol. Its IUPAC name is 2-bromo-2-methyl-1-(2-methyl-3,4-dihydro-2H-quinolin-1-yl)propan-1-one.
| Compound Name | 2-bromo-2-methyl-1-(2-methyl-3,4-dihydro-2H-quinolin-1-yl)propan-1-one |
|---|---|
| PubChem CID | 116816888 |
| Molecular Formula | C14H18BrNO |
| Molecular Weight | 296.21 g/mol |
| Exact Mass | 295.06 |
| IUPAC Name | 2-bromo-2-methyl-1-(2-methyl-3,4-dihydro-2H-quinolin-1-yl)propan-1-one |
| SMILES | CC1CCc2ccccc2N1C(=O)C(C)(C)Br |
| InChI | InChI=1S/C14H18BrNO/c1-10-8-9-11-6-4-5-7-12(11)16(10)13(17)14(2,3)15/h4-7,10H,8-9H2,1-3H3 |
| InChIKey | PKIUQIQSKVBTAQ-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.21 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|