C12H13Cl2NO — CID 22328468
2,2-dichloro-1-(2-methyl-3,4-dihydro-2H-quinolin-1-yl)ethanone (PubChem CID 22328468) has the molecular formula C12H13Cl2NO and a molecular weight of 258.15 g/mol. Its IUPAC name is 2,2-dichloro-1-(2-methyl-3,4-dihydro-2H-quinolin-1-yl)ethanone.
| Compound Name | 2,2-dichloro-1-(2-methyl-3,4-dihydro-2H-quinolin-1-yl)ethanone |
|---|---|
| PubChem CID | 22328468 |
| Molecular Formula | C12H13Cl2NO |
| Molecular Weight | 258.15 g/mol |
| Exact Mass | 257.04 |
| IUPAC Name | 2,2-dichloro-1-(2-methyl-3,4-dihydro-2H-quinolin-1-yl)ethanone |
| SMILES | CC1CCc2ccccc2N1C(=O)C(Cl)Cl |
| InChI | InChI=1S/C12H13Cl2NO/c1-8-6-7-9-4-2-3-5-10(9)15(8)12(16)11(13)14/h2-5,8,11H,6-7H2,1H3 |
| InChIKey | LPCHEYGJJBDGHB-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.15 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|