C28H28N2O2 — CID 7053300
[(2S,7S)-1-benzoyl-2,7-dimethyl-2,3,4,7,8,9-hexahydropyrido[2,3-g]quinolin-6-yl]-phenylmethanone (PubChem CID 7053300) has the molecular formula C28H28N2O2 and a molecular weight of 424.54 g/mol. Its IUPAC name is [(2S,7S)-1-benzoyl-2,7-dimethyl-2,3,4,7,8,9-hexahydropyrido[2,3-g]quinolin-6-yl]-phenylmethanone.
| Compound Name | [(2S,7S)-1-benzoyl-2,7-dimethyl-2,3,4,7,8,9-hexahydropyrido[2,3-g]quinolin-6-yl]-phenylmethanone |
|---|---|
| PubChem CID | 7053300 |
| Molecular Formula | C28H28N2O2 |
| Molecular Weight | 424.54 g/mol |
| Exact Mass | 424.22 |
| IUPAC Name | [(2S,7S)-1-benzoyl-2,7-dimethyl-2,3,4,7,8,9-hexahydropyrido[2,3-g]quinolin-6-yl]-phenylmethanone |
| SMILES | C[C@H]1CCc2cc3c(cc2N1C(=O)c1ccccc1)CC[C@H](C)N3C(=O)c1ccccc1 |
| InChI | InChI=1S/C28H28N2O2/c1-19-13-15-23-18-26-24(17-25(23)29(19)27(31)21-9-5-3-6-10-21)16-14-20(2)30(26)28(32)22-11-7-4-8-12-22/h3-12,17-20H,13-16H2,1-2H3/t19-,20-/m0/s1 |
| InChIKey | VQFBLKMLTRLLEV-PMACEKPBSA-N |
| XLogP | 5.65 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.54 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |