C17H18N2O — CID 10515904
(2,4-dimethyl-2,3-dihydroquinoxalin-1-yl)-phenylmethanone (PubChem CID 10515904) has the molecular formula C17H18N2O and a molecular weight of 266.34 g/mol. Its IUPAC name is (2,4-dimethyl-2,3-dihydroquinoxalin-1-yl)-phenylmethanone.
| Compound Name | (2,4-dimethyl-2,3-dihydroquinoxalin-1-yl)-phenylmethanone |
|---|---|
| PubChem CID | 10515904 |
| Molecular Formula | C17H18N2O |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | (2,4-dimethyl-2,3-dihydroquinoxalin-1-yl)-phenylmethanone |
| SMILES | CC1CN(C)c2ccccc2N1C(=O)c1ccccc1 |
| InChI | InChI=1S/C17H18N2O/c1-13-12-18(2)15-10-6-7-11-16(15)19(13)17(20)14-8-4-3-5-9-14/h3-11,13H,12H2,1-2H3 |
| InChIKey | NGABWUHGFQLECB-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |