C25H20Cl2N2O2 — CID 9497785
(5S,7S)-8-benzoyl-4,4-dichloro-7-methyl-5-phenyl-2,8-diazatricyclo[7.4.0.02,5]trideca-1(13),9,11-trien-3-one (PubChem CID 9497785) has the molecular formula C25H20Cl2N2O2 and a molecular weight of 451.35 g/mol. Its IUPAC name is (5S,7S)-8-benzoyl-4,4-dichloro-7-methyl-5-phenyl-2,8-diazatricyclo[7.4.0.02,5]trideca-1(13),9,11-trien-3-one.
| Compound Name | (5S,7S)-8-benzoyl-4,4-dichloro-7-methyl-5-phenyl-2,8-diazatricyclo[7.4.0.02,5]trideca-1(13),9,11-trien-3-one |
|---|---|
| PubChem CID | 9497785 |
| Molecular Formula | C25H20Cl2N2O2 |
| Molecular Weight | 451.35 g/mol |
| Exact Mass | 450.09 |
| IUPAC Name | (5S,7S)-8-benzoyl-4,4-dichloro-7-methyl-5-phenyl-2,8-diazatricyclo[7.4.0.02,5]trideca-1(13),9,11-trien-3-one |
| SMILES | C[C@H]1C[C@@]2(c3ccccc3)N(C(=O)C2(Cl)Cl)c2ccccc2N1C(=O)c1ccccc1 |
| InChI | InChI=1S/C25H20Cl2N2O2/c1-17-16-24(19-12-6-3-7-13-19)25(26,27)23(31)29(24)21-15-9-8-14-20(21)28(17)22(30)18-10-4-2-5-11-18/h2-15,17H,16H2,1H3/t17-,24-/m0/s1 |
| InChIKey | RJHGPGSQHSEPPK-XDHUDOTRSA-N |
| XLogP | 5.54 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.35 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|