C28H27N5OS — CID 22646350
N'-[4-[4-(2-anilinobenzoyl)piperazin-1-yl]phenyl]thiophene-2-carboximidamide (PubChem CID 22646350) has the molecular formula C28H27N5OS and a molecular weight of 481.63 g/mol. Its IUPAC name is N'-[4-[4-(2-anilinobenzoyl)piperazin-1-yl]phenyl]thiophene-2-carboximidamide.
| Compound Name | N'-[4-[4-(2-anilinobenzoyl)piperazin-1-yl]phenyl]thiophene-2-carboximidamide |
|---|---|
| PubChem CID | 22646350 |
| Molecular Formula | C28H27N5OS |
| Molecular Weight | 481.63 g/mol |
| Exact Mass | 481.19 |
| IUPAC Name | N'-[4-[4-(2-anilinobenzoyl)piperazin-1-yl]phenyl]thiophene-2-carboximidamide |
| SMILES | N/C(=N\c1ccc(N2CCN(C(=O)c3ccccc3Nc3ccccc3)CC2)cc1)c1cccs1 |
| InChI | InChI=1S/C28H27N5OS/c29-27(26-11-6-20-35-26)31-22-12-14-23(15-13-22)32-16-18-33(19-17-32)28(34)24-9-4-5-10-25(24)30-21-7-2-1-3-8-21/h1-15,20,30H,16-19H2,(H2,29,31) |
| InChIKey | DJBDHNRIAHNZNF-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 73.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.63 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|