C32H40N4O2S — CID 85104881
N'-[4-[4-[3-(3,5-ditert-butyl-4-hydroxyphenyl)prop-2-enoyl]piperazin-1-yl]phenyl]thiophene-2-carboximidamide (PubChem CID 85104881) has the molecular formula C32H40N4O2S and a molecular weight of 544.77 g/mol. Its IUPAC name is N'-[4-[4-[3-(3,5-ditert-butyl-4-hydroxyphenyl)prop-2-enoyl]piperazin-1-yl]phenyl]thiophene-2-carboximidamide.
| Compound Name | N'-[4-[4-[3-(3,5-ditert-butyl-4-hydroxyphenyl)prop-2-enoyl]piperazin-1-yl]phenyl]thiophene-2-carboximidamide |
|---|---|
| PubChem CID | 85104881 |
| Molecular Formula | C32H40N4O2S |
| Molecular Weight | 544.77 g/mol |
| Exact Mass | 544.29 |
| IUPAC Name | N'-[4-[4-[3-(3,5-ditert-butyl-4-hydroxyphenyl)prop-2-enoyl]piperazin-1-yl]phenyl]thiophene-2-carboximidamide |
| SMILES | CC(C)(C)c1cc(C=CC(=O)N2CCN(c3ccc(/N=C(\N)c4cccs4)cc3)CC2)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C32H40N4O2S/c1-31(2,3)25-20-22(21-26(29(25)38)32(4,5)6)9-14-28(37)36-17-15-35(16-18-36)24-12-10-23(11-13-24)34-30(33)27-8-7-19-39-27/h7-14,19-21,38H,15-18H2,1-6H3,(H2,33,34) |
| InChIKey | SNLVWAGIWHLWOH-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 82.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.77 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|