C32H41N5O4 — CID 136653060
N'-[4-[4-[3-(3,5-dibutoxy-4-hydroxyphenyl)prop-2-enoyl]piperazin-1-yl]phenyl]-1H-pyrrole-2-carboximidamide (PubChem CID 136653060) has the molecular formula C32H41N5O4 and a molecular weight of 559.71 g/mol. Its IUPAC name is N'-[4-[4-[3-(3,5-dibutoxy-4-hydroxyphenyl)prop-2-enoyl]piperazin-1-yl]phenyl]-1H-pyrrole-2-carboximidamide.
| Compound Name | N'-[4-[4-[3-(3,5-dibutoxy-4-hydroxyphenyl)prop-2-enoyl]piperazin-1-yl]phenyl]-1H-pyrrole-2-carboximidamide |
|---|---|
| PubChem CID | 136653060 |
| Molecular Formula | C32H41N5O4 |
| Molecular Weight | 559.71 g/mol |
| Exact Mass | 559.32 |
| IUPAC Name | N'-[4-[4-[3-(3,5-dibutoxy-4-hydroxyphenyl)prop-2-enoyl]piperazin-1-yl]phenyl]-1H-pyrrole-2-carboximidamide |
| SMILES | CCCCOc1cc(C=CC(=O)N2CCN(c3ccc(/N=C(\N)c4ccc[nH]4)cc3)CC2)cc(OCCCC)c1O |
| InChI | InChI=1S/C32H41N5O4/c1-3-5-20-40-28-22-24(23-29(31(28)39)41-21-6-4-2)9-14-30(38)37-18-16-36(17-19-37)26-12-10-25(11-13-26)35-32(33)27-8-7-15-34-27/h7-15,22-23,34,39H,3-6,16-21H2,1-2H3,(H2,33,35) |
| InChIKey | JERXIMAIQMMUHF-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 116.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.71 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|