C23H27N3O5 — CID 55742942
(E)-3-(3-methoxy-4-propoxyphenyl)-1-[4-(3-nitrophenyl)piperazin-1-yl]prop-2-en-1-one (PubChem CID 55742942) has the molecular formula C23H27N3O5 and a molecular weight of 425.49 g/mol. Its IUPAC name is (E)-3-(3-methoxy-4-propoxyphenyl)-1-[4-(3-nitrophenyl)piperazin-1-yl]prop-2-en-1-one.
| Compound Name | (E)-3-(3-methoxy-4-propoxyphenyl)-1-[4-(3-nitrophenyl)piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 55742942 |
| Molecular Formula | C23H27N3O5 |
| Molecular Weight | 425.49 g/mol |
| Exact Mass | 425.20 |
| IUPAC Name | (E)-3-(3-methoxy-4-propoxyphenyl)-1-[4-(3-nitrophenyl)piperazin-1-yl]prop-2-en-1-one |
| SMILES | CCCOc1ccc(/C=C/C(=O)N2CCN(c3cccc([N+](=O)[O-])c3)CC2)cc1OC |
| InChI | InChI=1S/C23H27N3O5/c1-3-15-31-21-9-7-18(16-22(21)30-2)8-10-23(27)25-13-11-24(12-14-25)19-5-4-6-20(17-19)26(28)29/h4-10,16-17H,3,11-15H2,1-2H3/b10-8+ |
| InChIKey | IODYOYCZKCHYNQ-CSKARUKUSA-N |
| XLogP | 3.75 |
| TPSA | 85.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.49 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|