C33H38N2O7 — CID 19421688
(E)-3-[3-(3-methoxy-4-propoxyphenyl)phenyl]-1-[4-(3,4,5-trimethoxybenzoyl)piperazin-1-yl]prop-2-en-1-one (PubChem CID 19421688) has the molecular formula C33H38N2O7 and a molecular weight of 574.67 g/mol. Its IUPAC name is (E)-3-[3-(3-methoxy-4-propoxyphenyl)phenyl]-1-[4-(3,4,5-trimethoxybenzoyl)piperazin-1-yl]prop-2-en-1-one.
| Compound Name | (E)-3-[3-(3-methoxy-4-propoxyphenyl)phenyl]-1-[4-(3,4,5-trimethoxybenzoyl)piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 19421688 |
| Molecular Formula | C33H38N2O7 |
| Molecular Weight | 574.67 g/mol |
| Exact Mass | 574.27 |
| IUPAC Name | (E)-3-[3-(3-methoxy-4-propoxyphenyl)phenyl]-1-[4-(3,4,5-trimethoxybenzoyl)piperazin-1-yl]prop-2-en-1-one |
| SMILES | CCCOc1ccc(-c2cccc(/C=C/C(=O)N3CCN(C(=O)c4cc(OC)c(OC)c(OC)c4)CC3)c2)cc1OC |
| InChI | InChI=1S/C33H38N2O7/c1-6-18-42-27-12-11-25(20-28(27)38-2)24-9-7-8-23(19-24)10-13-31(36)34-14-16-35(17-15-34)33(37)26-21-29(39-3)32(41-5)30(22-26)40-4/h7-13,19-22H,6,14-18H2,1-5H3/b13-10+ |
| InChIKey | SPIGBEWWTDUDDL-JLHYYAGUSA-N |
| XLogP | 5.17 |
| TPSA | 86.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.67 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|