C32H36N2O6 — CID 19421663
(E)-3-phenyl-3-(3-propoxyphenyl)-1-[4-(3,4,5-trimethoxybenzoyl)piperazin-1-yl]prop-2-en-1-one (PubChem CID 19421663) has the molecular formula C32H36N2O6 and a molecular weight of 544.65 g/mol. Its IUPAC name is (E)-3-phenyl-3-(3-propoxyphenyl)-1-[4-(3,4,5-trimethoxybenzoyl)piperazin-1-yl]prop-2-en-1-one.
| Compound Name | (E)-3-phenyl-3-(3-propoxyphenyl)-1-[4-(3,4,5-trimethoxybenzoyl)piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 19421663 |
| Molecular Formula | C32H36N2O6 |
| Molecular Weight | 544.65 g/mol |
| Exact Mass | 544.26 |
| IUPAC Name | (E)-3-phenyl-3-(3-propoxyphenyl)-1-[4-(3,4,5-trimethoxybenzoyl)piperazin-1-yl]prop-2-en-1-one |
| SMILES | CCCOc1cccc(/C(=C/C(=O)N2CCN(C(=O)c3cc(OC)c(OC)c(OC)c3)CC2)c2ccccc2)c1 |
| InChI | InChI=1S/C32H36N2O6/c1-5-18-40-26-13-9-12-24(19-26)27(23-10-7-6-8-11-23)22-30(35)33-14-16-34(17-15-33)32(36)25-20-28(37-2)31(39-4)29(21-25)38-3/h6-13,19-22H,5,14-18H2,1-4H3/b27-22+ |
| InChIKey | KFWIOPZGDCPKMW-HPNDGRJYSA-N |
| XLogP | 4.92 |
| TPSA | 77.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.65 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|