C30H30Cl2N2O6 — CID 19421547
(Z)-3-(2,6-dichlorophenyl)-3-(4-methoxyphenyl)-1-[4-(3,4,5-trimethoxybenzoyl)piperazin-1-yl]prop-2-en-1-one (PubChem CID 19421547) has the molecular formula C30H30Cl2N2O6 and a molecular weight of 585.48 g/mol. Its IUPAC name is (Z)-3-(2,6-dichlorophenyl)-3-(4-methoxyphenyl)-1-[4-(3,4,5-trimethoxybenzoyl)piperazin-1-yl]prop-2-en-1-one.
| Compound Name | (Z)-3-(2,6-dichlorophenyl)-3-(4-methoxyphenyl)-1-[4-(3,4,5-trimethoxybenzoyl)piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 19421547 |
| Molecular Formula | C30H30Cl2N2O6 |
| Molecular Weight | 585.48 g/mol |
| Exact Mass | 584.15 |
| IUPAC Name | (Z)-3-(2,6-dichlorophenyl)-3-(4-methoxyphenyl)-1-[4-(3,4,5-trimethoxybenzoyl)piperazin-1-yl]prop-2-en-1-one |
| SMILES | COc1ccc(/C(=C/C(=O)N2CCN(C(=O)c3cc(OC)c(OC)c(OC)c3)CC2)c2c(Cl)cccc2Cl)cc1 |
| InChI | InChI=1S/C30H30Cl2N2O6/c1-37-21-10-8-19(9-11-21)22(28-23(31)6-5-7-24(28)32)18-27(35)33-12-14-34(15-13-33)30(36)20-16-25(38-2)29(40-4)26(17-20)39-3/h5-11,16-18H,12-15H2,1-4H3/b22-18- |
| InChIKey | APLYSIAQRYNIMI-PYCFMQQDSA-N |
| XLogP | 5.44 |
| TPSA | 77.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.48 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|