C32H35FN2O8 — CID 67731504
(Z)-3-(4-fluorophenyl)-1-[4-(3,4,5-trimethoxybenzoyl)piperazin-1-yl]-3-(3,4,5-trimethoxyphenyl)prop-2-en-1-one (PubChem CID 67731504) has the molecular formula C32H35FN2O8 and a molecular weight of 594.64 g/mol. Its IUPAC name is (Z)-3-(4-fluorophenyl)-1-[4-(3,4,5-trimethoxybenzoyl)piperazin-1-yl]-3-(3,4,5-trimethoxyphenyl)prop-2-en-1-one.
| Compound Name | (Z)-3-(4-fluorophenyl)-1-[4-(3,4,5-trimethoxybenzoyl)piperazin-1-yl]-3-(3,4,5-trimethoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 67731504 |
| Molecular Formula | C32H35FN2O8 |
| Molecular Weight | 594.64 g/mol |
| Exact Mass | 594.24 |
| IUPAC Name | (Z)-3-(4-fluorophenyl)-1-[4-(3,4,5-trimethoxybenzoyl)piperazin-1-yl]-3-(3,4,5-trimethoxyphenyl)prop-2-en-1-one |
| SMILES | COc1cc(C(=O)N2CCN(C(=O)/C=C(/c3ccc(F)cc3)c3cc(OC)c(OC)c(OC)c3)CC2)cc(OC)c1OC |
| InChI | InChI=1S/C32H35FN2O8/c1-38-25-15-21(16-26(39-2)30(25)42-5)24(20-7-9-23(33)10-8-20)19-29(36)34-11-13-35(14-12-34)32(37)22-17-27(40-3)31(43-6)28(18-22)41-4/h7-10,15-19H,11-14H2,1-6H3/b24-19- |
| InChIKey | KQOMSDCIIAEIBQ-CLCOLTQESA-N |
| XLogP | 4.29 |
| TPSA | 96.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.64 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|