C29H28F2N2O5 — CID 15230543
3,3-bis(4-fluorophenyl)-1-[4-(3,4,5-trimethoxybenzoyl)piperazin-1-yl]prop-2-en-1-one (PubChem CID 15230543) has the molecular formula C29H28F2N2O5 and a molecular weight of 522.55 g/mol. Its IUPAC name is 3,3-bis(4-fluorophenyl)-1-[4-(3,4,5-trimethoxybenzoyl)piperazin-1-yl]prop-2-en-1-one.
| Compound Name | 3,3-bis(4-fluorophenyl)-1-[4-(3,4,5-trimethoxybenzoyl)piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 15230543 |
| Molecular Formula | C29H28F2N2O5 |
| Molecular Weight | 522.55 g/mol |
| Exact Mass | 522.20 |
| IUPAC Name | 3,3-bis(4-fluorophenyl)-1-[4-(3,4,5-trimethoxybenzoyl)piperazin-1-yl]prop-2-en-1-one |
| SMILES | COc1cc(C(=O)N2CCN(C(=O)C=C(c3ccc(F)cc3)c3ccc(F)cc3)CC2)cc(OC)c1OC |
| InChI | InChI=1S/C29H28F2N2O5/c1-36-25-16-21(17-26(37-2)28(25)38-3)29(35)33-14-12-32(13-15-33)27(34)18-24(19-4-8-22(30)9-5-19)20-6-10-23(31)11-7-20/h4-11,16-18H,12-15H2,1-3H3 |
| InChIKey | KBHJSXPACBJUPJ-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.55 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|