C35H42N2O7 — CID 19421610
(E)-3-(3,4-dipropoxyphenyl)-3-phenyl-1-[4-(3,4,5-trimethoxybenzoyl)piperazin-1-yl]prop-2-en-1-one (PubChem CID 19421610) has the molecular formula C35H42N2O7 and a molecular weight of 602.73 g/mol. Its IUPAC name is (E)-3-(3,4-dipropoxyphenyl)-3-phenyl-1-[4-(3,4,5-trimethoxybenzoyl)piperazin-1-yl]prop-2-en-1-one.
| Compound Name | (E)-3-(3,4-dipropoxyphenyl)-3-phenyl-1-[4-(3,4,5-trimethoxybenzoyl)piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 19421610 |
| Molecular Formula | C35H42N2O7 |
| Molecular Weight | 602.73 g/mol |
| Exact Mass | 602.30 |
| IUPAC Name | (E)-3-(3,4-dipropoxyphenyl)-3-phenyl-1-[4-(3,4,5-trimethoxybenzoyl)piperazin-1-yl]prop-2-en-1-one |
| SMILES | CCCOc1ccc(/C(=C/C(=O)N2CCN(C(=O)c3cc(OC)c(OC)c(OC)c3)CC2)c2ccccc2)cc1OCCC |
| InChI | InChI=1S/C35H42N2O7/c1-6-19-43-29-14-13-26(21-30(29)44-20-7-2)28(25-11-9-8-10-12-25)24-33(38)36-15-17-37(18-16-36)35(39)27-22-31(40-3)34(42-5)32(23-27)41-4/h8-14,21-24H,6-7,15-20H2,1-5H3/b28-24+ |
| InChIKey | QQGSFEXJCIPHJV-ZZIIXHQDSA-N |
| XLogP | 5.71 |
| TPSA | 86.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.73 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|