C32H35ClN2O6 — CID 54300365
3-(3-chloro-5-methylphenyl)-3-(4-ethoxyphenyl)-1-[4-(3,4,5-trimethoxybenzoyl)piperazin-1-yl]prop-2-en-1-one (PubChem CID 54300365) has the molecular formula C32H35ClN2O6 and a molecular weight of 579.09 g/mol. Its IUPAC name is 3-(3-chloro-5-methylphenyl)-3-(4-ethoxyphenyl)-1-[4-(3,4,5-trimethoxybenzoyl)piperazin-1-yl]prop-2-en-1-one.
| Compound Name | 3-(3-chloro-5-methylphenyl)-3-(4-ethoxyphenyl)-1-[4-(3,4,5-trimethoxybenzoyl)piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 54300365 |
| Molecular Formula | C32H35ClN2O6 |
| Molecular Weight | 579.09 g/mol |
| Exact Mass | 578.22 |
| IUPAC Name | 3-(3-chloro-5-methylphenyl)-3-(4-ethoxyphenyl)-1-[4-(3,4,5-trimethoxybenzoyl)piperazin-1-yl]prop-2-en-1-one |
| SMILES | CCOc1ccc(C(=CC(=O)N2CCN(C(=O)c3cc(OC)c(OC)c(OC)c3)CC2)c2cc(C)cc(Cl)c2)cc1 |
| InChI | InChI=1S/C32H35ClN2O6/c1-6-41-26-9-7-22(8-10-26)27(23-15-21(2)16-25(33)17-23)20-30(36)34-11-13-35(14-12-34)32(37)24-18-28(38-3)31(40-5)29(19-24)39-4/h7-10,15-20H,6,11-14H2,1-5H3 |
| InChIKey | SDTGPIYUBUQXSG-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 77.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.09 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|