C24H28N2O8 — CID 108929525
ethyl [4-[4-(3,4,5-trimethoxybenzoyl)piperazine-1-carbonyl]phenyl] carbonate (PubChem CID 108929525) has the molecular formula C24H28N2O8 and a molecular weight of 472.49 g/mol. Its IUPAC name is ethyl [4-[4-(3,4,5-trimethoxybenzoyl)piperazine-1-carbonyl]phenyl] carbonate.
| Compound Name | ethyl [4-[4-(3,4,5-trimethoxybenzoyl)piperazine-1-carbonyl]phenyl] carbonate |
|---|---|
| PubChem CID | 108929525 |
| Molecular Formula | C24H28N2O8 |
| Molecular Weight | 472.49 g/mol |
| Exact Mass | 472.18 |
| IUPAC Name | ethyl [4-[4-(3,4,5-trimethoxybenzoyl)piperazine-1-carbonyl]phenyl] carbonate |
| SMILES | CCOC(=O)Oc1ccc(C(=O)N2CCN(C(=O)c3cc(OC)c(OC)c(OC)c3)CC2)cc1 |
| InChI | InChI=1S/C24H28N2O8/c1-5-33-24(29)34-18-8-6-16(7-9-18)22(27)25-10-12-26(13-11-25)23(28)17-14-19(30-2)21(32-4)20(15-17)31-3/h6-9,14-15H,5,10-13H2,1-4H3 |
| InChIKey | TYCJPVBCLSUOJD-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 103.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.49 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|