C25H27NO8 — CID 108762613
[4-(7,8-dimethoxy-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-carbonyl)phenyl] ethyl carbonate (PubChem CID 108762613) has the molecular formula C25H27NO8 and a molecular weight of 469.49 g/mol. Its IUPAC name is [4-(7,8-dimethoxy-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-carbonyl)phenyl] ethyl carbonate.
| Compound Name | [4-(7,8-dimethoxy-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-carbonyl)phenyl] ethyl carbonate |
|---|---|
| PubChem CID | 108762613 |
| Molecular Formula | C25H27NO8 |
| Molecular Weight | 469.49 g/mol |
| Exact Mass | 469.17 |
| IUPAC Name | [4-(7,8-dimethoxy-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-carbonyl)phenyl] ethyl carbonate |
| SMILES | CCOC(=O)Oc1ccc(C(=O)N2CCC3(CC2)CC(=O)c2ccc(OC)c(OC)c2O3)cc1 |
| InChI | InChI=1S/C25H27NO8/c1-4-32-24(29)33-17-7-5-16(6-8-17)23(28)26-13-11-25(12-14-26)15-19(27)18-9-10-20(30-2)22(31-3)21(18)34-25/h5-10H,4,11-15H2,1-3H3 |
| InChIKey | DACBGHAZTKRGIG-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 100.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.49 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|