C31H32F2N2O6 — CID 67731425
(E)-3-(3,5-difluorophenyl)-3-(4-ethoxyphenyl)-1-[4-(3,4,5-trimethoxybenzoyl)piperazin-1-yl]prop-2-en-1-one (PubChem CID 67731425) has the molecular formula C31H32F2N2O6 and a molecular weight of 566.60 g/mol. Its IUPAC name is (E)-3-(3,5-difluorophenyl)-3-(4-ethoxyphenyl)-1-[4-(3,4,5-trimethoxybenzoyl)piperazin-1-yl]prop-2-en-1-one.
| Compound Name | (E)-3-(3,5-difluorophenyl)-3-(4-ethoxyphenyl)-1-[4-(3,4,5-trimethoxybenzoyl)piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 67731425 |
| Molecular Formula | C31H32F2N2O6 |
| Molecular Weight | 566.60 g/mol |
| Exact Mass | 566.22 |
| IUPAC Name | (E)-3-(3,5-difluorophenyl)-3-(4-ethoxyphenyl)-1-[4-(3,4,5-trimethoxybenzoyl)piperazin-1-yl]prop-2-en-1-one |
| SMILES | CCOc1ccc(/C(=C\C(=O)N2CCN(C(=O)c3cc(OC)c(OC)c(OC)c3)CC2)c2cc(F)cc(F)c2)cc1 |
| InChI | InChI=1S/C31H32F2N2O6/c1-5-41-25-8-6-20(7-9-25)26(21-14-23(32)18-24(33)15-21)19-29(36)34-10-12-35(13-11-34)31(37)22-16-27(38-2)30(40-4)28(17-22)39-3/h6-9,14-19H,5,10-13H2,1-4H3/b26-19+ |
| InChIKey | VDVWPYRJWPCXQK-LGUFXXKBSA-N |
| XLogP | 4.81 |
| TPSA | 77.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.60 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|